CAS 113793-31-0 is the registry number for 3-Hydroxy-2-(4-methoxybenzenesulfonamido)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3R)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoic acid (CAS 113793-31-0) is a chemical compound with the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. IUPAC name: (2S,3R)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoic acid. InChIKey: VJAHSOIECXJUPQ-XCBNKYQSSA-N.
| Molecular formula | C11H15NO6S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanoic acid |
| InChIKey | VJAHSOIECXJUPQ-XCBNKYQSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)OC)O |
Computed by PubChem (NCBI)