CAS 95936-53-1 is the registry number for 2-Beta-D-Ribofuranosyl-4-thiazolecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
Ethyl 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboxylate (CAS 95936-53-1) is a chemical compound with the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. IUPAC name: ethyl 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboxylate. InChIKey: KQTOKYAUJBRPST-FNCVBFRFSA-N.
| Molecular formula | C11H15NO6S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | ethyl 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboxylate |
| InChIKey | KQTOKYAUJBRPST-FNCVBFRFSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)