CAS 363572-86-5 appears in our catalog under these names: N-(2,4-Dimethoxyphenyl)-n-(methylsulfonyl)-glycine, 95%, 2-(N-(2,4-Dimethoxyphenyl)methylsulfonamido)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,4-dimethoxy-N-methylsulfonylanilino)acetic acid (CAS 363572-86-5) is a chemical compound with the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. IUPAC name: 2-(2,4-dimethoxy-N-methylsulfonylanilino)acetic acid. InChIKey: QEFVADPJRBYYQS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 2-(2,4-dimethoxy-N-methylsulfonylanilino)acetic acid |
| InChIKey | QEFVADPJRBYYQS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N(CC(=O)O)S(=O)(=O)C)OC |
Computed by PubChem (NCBI)