Products 886498-68-6
CAS 886498-68-6 is the registry number for methyl 2-(4,5-dimethoxy-2-sulfamoylphenyl)acetate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 10000mg.
Methyl 2-(4,5-dimethoxy-2-sulfamoylphenyl)acetate (CAS 886498-68-6) is a chemical compound with the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. IUPAC name: methyl 2-(4,5-dimethoxy-2-sulfamoylphenyl)acetate. InChIKey: OOGCPSDZBJSPKW-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | methyl 2-(4,5-dimethoxy-2-sulfamoylphenyl)acetate |
| InChIKey | OOGCPSDZBJSPKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)OC)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)