CAS 746655-80-1 appears in our catalog under these names: 3-([(3,4-Dimethoxyphenyl)sulfonyl]amino)propanoic acid, 95%, 3-(3,4-Dimethoxybenzenesulfonamido)propanoic acid, 95%, 3-(3,4-Dimethoxybenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 2,5g.
3-[(3,4-dimethoxyphenyl)sulfonylamino]propanoic acid (CAS 746655-80-1) is a chemical compound with the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. IUPAC name: 3-[(3,4-dimethoxyphenyl)sulfonylamino]propanoic acid. InChIKey: PAAMXIJQFGQXJN-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]propanoic acid |
| InChIKey | PAAMXIJQFGQXJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)NCCC(=O)O)OC |
Computed by PubChem (NCBI)