CAS 1138220-76-4 is the registry number for 6-Methoxy-5-methyl-2,3-dihydro-1H-isoindol-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-methoxy-5-methyl-2,3-dihydroisoindol-1-one (CAS 1138220-76-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-methoxy-5-methyl-2,3-dihydroisoindol-1-one. InChIKey: BTWSJGZHCFLRDH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-methoxy-5-methyl-2,3-dihydroisoindol-1-one |
| InChIKey | BTWSJGZHCFLRDH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1OC)C(=O)NC2 |
Computed by PubChem (NCBI)