CAS 113850-96-7 appears in our catalog under these names: 7-Bromo-4-oxo-4H-chromene-2-carboxylic acid, ≥96%, ≥96%, 7-Bromochromone-2-carboxylic acid, 7-Bromo-4-oxo-4H-1-benzopyran-2-carboxylic acid, 95-<97%, 7-Bromo-4-oxo-4H-chromene-2-carboxylic acid, 98%. Offered by: Chemat, Biosynth, Hoffman Fine Chemicals, AmBeed, Fluorochem. Available pack sizes: 50mg, 250mg, 1g, 0,1g, 0,05g, 0,25g, 0,5g, 2,5g.
7-bromo-4-oxochromene-2-carboxylic acid (CAS 113850-96-7) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 7-bromo-4-oxochromene-2-carboxylic acid. InChIKey: VACMFRPTBQYGGH-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO4 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 7-bromo-4-oxochromene-2-carboxylic acid |
| InChIKey | VACMFRPTBQYGGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)