CAS 1392804-26-0 appears in our catalog under these names: 2-Acetyl-6-bromo-benzofuran-4,7-dione, 95%, 2-Acetyl-6-bromobenzofuran-4,7-dione, 97%, 2-Acetyl-6-bromobenzofuran-4,7-dione, 97%, 97%, 2-ACETYL-6-BROMO-BENZOFURAN-4,7-DIONE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g, 500mg.
2-acetyl-6-bromo-1-benzofuran-4,7-dione (CAS 1392804-26-0) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 2-acetyl-6-bromo-1-benzofuran-4,7-dione. InChIKey: QJVVOTLTRAGKEC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO4 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 2-acetyl-6-bromo-1-benzofuran-4,7-dione |
| InChIKey | QJVVOTLTRAGKEC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(O1)C(=O)C(=CC2=O)Br |
Computed by PubChem (NCBI)