CAS 1389264-29-2 appears in our catalog under these names: 2-Acetyl-5-bromobenzofuran-4,7-dione, 97%, 2-ACETYL-5-BROMO-BENZOFURAN-4,7-DIONE, 97%, 2-Acetyl-5-bromo-4,7-dihydro-1-benzofuran-4,7-dione, 95%, 2–acetyl–5–bromo–4,7–dihydro–1–benzofuran–4,7–dione, 2-acetyl-5-bromo-4,7-dihydro-1-benzofuran-4,7-dione, ≥97%, ≥97%. Offered by: AmBeed, Fluorochem, Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-acetyl-5-bromo-1-benzofuran-4,7-dione (CAS 1389264-29-2) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 2-acetyl-5-bromo-1-benzofuran-4,7-dione. InChIKey: KDVZWDYCCQHJPF-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO4 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 2-acetyl-5-bromo-1-benzofuran-4,7-dione |
| InChIKey | KDVZWDYCCQHJPF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(O1)C(=O)C=C(C2=O)Br |
Computed by PubChem (NCBI)