Products 54682-43-8

CAS 54682-43-8 is the registry number for 5-Bromo-2-oxo-2H-chromene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-2-oxochromene-3-carboxylic acid (CAS 54682-43-8) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 5-bromo-2-oxochromene-3-carboxylic acid. InChIKey: YQWJEBREUGTJPY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrO4
Molecular weight269.05 g/mol
IUPAC name5-bromo-2-oxochromene-3-carboxylic acid
InChIKeyYQWJEBREUGTJPY-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C(C(=O)O2)C(=O)O)C(=C1)Br

Computed by PubChem (NCBI)