Products 94032-63-0

CAS 94032-63-0 is the registry number for 8-Bromo-2-oxo-2h-chromene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

8-bromo-2-oxochromene-3-carboxylic acid (CAS 94032-63-0) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 8-bromo-2-oxochromene-3-carboxylic acid. InChIKey: KCCRICDVGQYVMI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5BrO4
Molecular weight269.05 g/mol
IUPAC name8-bromo-2-oxochromene-3-carboxylic acid
InChIKeyKCCRICDVGQYVMI-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Br)OC(=O)C(=C2)C(=O)O

Computed by PubChem (NCBI)