CAS 113899-82-4 is the registry number for Methyl 4-formyl-2,6-dimethylbenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-formyl-2,6-dimethylbenzoate (CAS 113899-82-4) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 4-formyl-2,6-dimethylbenzoate. InChIKey: YDEBOIHJQFXXBK-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl 4-formyl-2,6-dimethylbenzoate |
| InChIKey | YDEBOIHJQFXXBK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)C)C=O |
Computed by PubChem (NCBI)