Products 113899-82-4

CAS 113899-82-4 is the registry number for Methyl 4-formyl-2,6-dimethylbenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-formyl-2,6-dimethylbenzoate (CAS 113899-82-4) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 4-formyl-2,6-dimethylbenzoate. InChIKey: YDEBOIHJQFXXBK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC namemethyl 4-formyl-2,6-dimethylbenzoate
InChIKeyYDEBOIHJQFXXBK-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C(=O)OC)C)C=O

Computed by PubChem (NCBI)