CAS 522615-29-8 appears in our catalog under these names: 3-(2-Chlorophenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95%, 3-(2-Chlorophenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 522615-29-8) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: XBABASIBBODKAE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | XBABASIBBODKAE-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)