CAS 113984-71-7 is the registry number for 2-Fluoro-3,5-dimethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-fluoro-3,5-dimethoxybenzaldehyde (CAS 113984-71-7) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-fluoro-3,5-dimethoxybenzaldehyde. InChIKey: IGSBMXVKCRCQTB-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-fluoro-3,5-dimethoxybenzaldehyde |
| InChIKey | IGSBMXVKCRCQTB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)F)C=O |
Computed by PubChem (NCBI)