Products 114031-67-3
CAS 114031-67-3 appears in our catalog under these names: 4-Hydroxy-4’-(trimethylacetoxy)benzophenone, 4-(4-Hydroxybenzoyl)phenyl pivalate, 95%, 95%, 4-(4-Hydroxybenzoyl)phenyl pivalate, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g.
[4-(4-hydroxybenzoyl)phenyl] 2,2-dimethylpropanoate (CAS 114031-67-3) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: [4-(4-hydroxybenzoyl)phenyl] 2,2-dimethylpropanoate. InChIKey: KSBBNJZVDXSJKO-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | [4-(4-hydroxybenzoyl)phenyl] 2,2-dimethylpropanoate |
| InChIKey | KSBBNJZVDXSJKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)