Products 114108-87-1

CAS 114108-87-1 appears in our catalog under these names: Cyclohexyl(Ethyl)sulfamoyl chloride, 95%, Cyclohexyl(ethyl)sulfamoyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

N-cyclohexyl-N-ethylsulfamoyl chloride (CAS 114108-87-1) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: N-cyclohexyl-N-ethylsulfamoyl chloride. InChIKey: BRDCOXLJAUYXRI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2S
Molecular weight225.74 g/mol
IUPAC nameN-cyclohexyl-N-ethylsulfamoyl chloride
InChIKeyBRDCOXLJAUYXRI-UHFFFAOYSA-N
SMILESCCN(C1CCCCC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)