CAS 2377036-35-4 is the registry number for 1-(Aminomethyl)-6λâ¶-thiaspiro(2.5)octane-6,6-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(6,6-dioxo-6lambda6-thiaspiro[2.5]octan-2-yl)methanamine;hydrochloride (CAS 2377036-35-4) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: (6,6-dioxo-6lambda6-thiaspiro[2.5]octan-2-yl)methanamine;hydrochloride. InChIKey: HEUVCJBEUAQUEF-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | (6,6-dioxo-6lambda6-thiaspiro[2.5]octan-2-yl)methanamine;hydrochloride |
| InChIKey | HEUVCJBEUAQUEF-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12CC2CN.Cl |
Computed by PubChem (NCBI)