CAS 329325-20-4 is the registry number for N-Allyl-3-methyltetrahydro-3-thiophenamine 1,1-dioxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride (CAS 329325-20-4) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride. InChIKey: RWCWUBODBXPCGP-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride |
| InChIKey | RWCWUBODBXPCGP-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C1)NCC=C.Cl |
Computed by PubChem (NCBI)