Products 329325-20-4

CAS 329325-20-4 is the registry number for N-Allyl-3-methyltetrahydro-3-thiophenamine 1,1-dioxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride (CAS 329325-20-4) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride. InChIKey: RWCWUBODBXPCGP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2S
Molecular weight225.74 g/mol
IUPAC name3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride
InChIKeyRWCWUBODBXPCGP-UHFFFAOYSA-N
SMILESCC1(CCS(=O)(=O)C1)NCC=C.Cl

Computed by PubChem (NCBI)