CAS 2094866-34-7 is the registry number for 3-(Aminomethyl)-8-thiabicyclo(3.2.1)octane 8,8-dioxide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octan-3-yl)methanamine;hydrochloride (CAS 2094866-34-7) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: (8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octan-3-yl)methanamine;hydrochloride. InChIKey: CEBCCQJGAYIFJB-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | (8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octan-3-yl)methanamine;hydrochloride |
| InChIKey | CEBCCQJGAYIFJB-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1S2(=O)=O)CN.Cl |
Computed by PubChem (NCBI)