CAS 2138129-71-0 appears in our catalog under these names: 8-Amino-5-thiaspiro(3.5)nonane 5,5-dioxide hydrochloride, 98%, 5-​Thiaspiro(3.5)​nonan-​8-​amine 5,​5-​dioxide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-8-amine;hydrochloride (CAS 2138129-71-0) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: 5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-8-amine;hydrochloride. InChIKey: PLLLYOAVJPICOI-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | 5,5-dioxo-5lambda6-thiaspiro[3.5]nonan-8-amine;hydrochloride |
| InChIKey | PLLLYOAVJPICOI-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(CCS2(=O)=O)N.Cl |
Computed by PubChem (NCBI)