CAS 114114-88-4 is the registry number for (S)-1-Methoxypropan-2-yl 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-1-methoxypropan-2-yl] 4-methylbenzenesulfonate (CAS 114114-88-4) is a chemical compound with the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. IUPAC name: [(2S)-1-methoxypropan-2-yl] 4-methylbenzenesulfonate. InChIKey: QPPFIRCWDRIUEZ-JTQLQIEISA-N.
| Molecular formula | C11H16O4S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | [(2S)-1-methoxypropan-2-yl] 4-methylbenzenesulfonate |
| InChIKey | QPPFIRCWDRIUEZ-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@@H](C)COC |
Computed by PubChem (NCBI)