Products 82614-88-8
CAS 82614-88-8 is the registry number for (S)-Toluene-4-sulfonic acid 3-hydroxybutyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(3S)-3-hydroxybutyl] 4-methylbenzenesulfonate (CAS 82614-88-8) is a chemical compound with the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. IUPAC name: [(3S)-3-hydroxybutyl] 4-methylbenzenesulfonate. InChIKey: HELSCPRKLIJMBU-JTQLQIEISA-N.
| Molecular formula | C11H16O4S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | [(3S)-3-hydroxybutyl] 4-methylbenzenesulfonate |
| InChIKey | HELSCPRKLIJMBU-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC[C@H](C)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-Toluene-4-sulfonic acid 3-hydroxybutyl ester, (S)-3-hydroxybutyl 4-methylbenzenesulfonate, HELSCPRKLIJMBU-JTQLQIEISA-N, (S)-3-hyrdoxybutyl p-toluenesulfonate, (S)-3-hydroxybutyl toluene-4-sulphonate, (S)-toluene-4-sulfonic acid 3-hydroxy-butyl ester, toluene-4-sulfonic acid-(S)-3-hydroxy-butyl ester