CAS 2384396-62-5 is the registry number for S-((1-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)cyclopropyl)methyl) Ethanethioate. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
S-[[1-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)cyclopropyl]methyl] ethanethioate (CAS 2384396-62-5) is a chemical compound with the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. IUPAC name: S-[[1-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)cyclopropyl]methyl] ethanethioate. InChIKey: DQUOTEJNEOBODG-UHFFFAOYSA-N.
| Molecular formula | C11H16O4S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | S-[[1-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)cyclopropyl]methyl] ethanethioate |
| InChIKey | DQUOTEJNEOBODG-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC1(CC1)C2C(=O)OC(O2)(C)C |
Computed by PubChem (NCBI)