Products 1183639-27-1
CAS 1183639-27-1 is the registry number for 2-Methyl-1-(4-(methylsulfonyl)phenoxy)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1-(4-methylsulfonylphenoxy)propan-2-ol (CAS 1183639-27-1) is a chemical compound with the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. IUPAC name: 2-methyl-1-(4-methylsulfonylphenoxy)propan-2-ol. InChIKey: VLGXFONMHSHLES-UHFFFAOYSA-N.
| Molecular formula | C11H16O4S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-methyl-1-(4-methylsulfonylphenoxy)propan-2-ol |
| InChIKey | VLGXFONMHSHLES-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC=C(C=C1)S(=O)(=O)C)O |
Computed by PubChem (NCBI)