Products 2287275-41-4

CAS 2287275-41-4 is the registry number for 2-Ethoxyethyl 2-methylbenzene-1-sulfonate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-ethoxyethyl 2-methylbenzenesulfonate (CAS 2287275-41-4) is a chemical compound with the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. IUPAC name: 2-ethoxyethyl 2-methylbenzenesulfonate. InChIKey: MJUMFRHYZWOWMS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O4S
Molecular weight244.31 g/mol
IUPAC name2-ethoxyethyl 2-methylbenzenesulfonate
InChIKeyMJUMFRHYZWOWMS-UHFFFAOYSA-N
SMILESCCOCCOS(=O)(=O)C1=CC=CC=C1C

Computed by PubChem (NCBI)