CAS 114165-30-9 appears in our catalog under these names: N-Acetyl-5-bromo-3-hydroxyindole, 95%, 1-Acetyl-5-bromoindol-3-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 1000mg.
1-(5-bromo-3-hydroxyindol-1-yl)ethanone (CAS 114165-30-9) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 1-(5-bromo-3-hydroxyindol-1-yl)ethanone. InChIKey: WOLVOYIZHIXSSE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 1-(5-bromo-3-hydroxyindol-1-yl)ethanone |
| InChIKey | WOLVOYIZHIXSSE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2)Br)O |
Computed by PubChem (NCBI)