CAS 1142210-36-3 is the registry number for [2-(4-Methylphenyl)-4-oxo-2,4-dihydro-5h-pyrazolo[3,4-d]pyrimidin-5-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[2-(4-methylphenyl)-4-oxopyrazolo[3,4-d]pyrimidin-5-yl]acetic acid (CAS 1142210-36-3) is a chemical compound with the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. IUPAC name: 2-[2-(4-methylphenyl)-4-oxopyrazolo[3,4-d]pyrimidin-5-yl]acetic acid. InChIKey: XPJPVBZSWRQTRN-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O3 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 2-[2-(4-methylphenyl)-4-oxopyrazolo[3,4-d]pyrimidin-5-yl]acetic acid |
| InChIKey | XPJPVBZSWRQTRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C3C(=N2)N=CN(C3=O)CC(=O)O |
Computed by PubChem (NCBI)