Products 1708079-86-0
CAS 1708079-86-0 is the registry number for 1-[4-(5-Ethyl-1,2,4-oxadiazol-3-yl)phenyl]-1h-pyrazole-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylic acid (CAS 1708079-86-0) is a chemical compound with the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. IUPAC name: 1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylic acid. InChIKey: KVVUZMQDBIYNDU-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O3 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylic acid |
| InChIKey | KVVUZMQDBIYNDU-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NO1)C2=CC=C(C=C2)N3C=CC(=N3)C(=O)O |
Computed by PubChem (NCBI)