CAS 4250-90-2 appears in our catalog under these names: Riboflavin Impurity 4 (Formylmethylflavin), Riboflavin Impurity Z, Riboflavin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)acetaldehyde (CAS 4250-90-2) is a chemical compound with the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. IUPAC name: 2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)acetaldehyde. InChIKey: AUZWNAFEXXLJDA-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O3 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)acetaldehyde |
| InChIKey | AUZWNAFEXXLJDA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC=O |
Computed by PubChem (NCBI)