CAS 122652-15-7 is the registry number for 2-(2-Methoxy-5-methyl-3-nitrophenyl)-2h-1,2,3-benzotriazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-methoxy-5-methyl-3-nitrophenyl)benzotriazole (CAS 122652-15-7) is a chemical compound with the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. IUPAC name: 2-(2-methoxy-5-methyl-3-nitrophenyl)benzotriazole. InChIKey: SYJWMZNZWXJFIU-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O3 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 2-(2-methoxy-5-methyl-3-nitrophenyl)benzotriazole |
| InChIKey | SYJWMZNZWXJFIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])OC)N2N=C3C=CC=CC3=N2 |
Computed by PubChem (NCBI)