Products 14663-28-6

CAS 14663-28-6 appears in our catalog under these names: Dantrolene Impurity 5, Dantrolene Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-[(E)-[5-(4-aminophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione (CAS 14663-28-6) is a chemical compound with the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. IUPAC name: 1-[(E)-[5-(4-aminophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione. InChIKey: UXUTWFLSENWVIM-FRKPEAEDSA-N.

Identity
Molecular formulaC14H12N4O3
Molecular weight284.27 g/mol
IUPAC name1-[(E)-[5-(4-aminophenyl)furan-2-yl]methylideneamino]imidazolidine-2,4-dione
InChIKeyUXUTWFLSENWVIM-FRKPEAEDSA-N
SMILESC1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)C3=CC=C(C=C3)N

Computed by PubChem (NCBI)