Products 1142210-92-1
CAS 1142210-92-1 is the registry number for tert-Butyl [(3z)-3-amino-3-(hydroxyimino)propyl]methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-methylcarbamate (CAS 1142210-92-1) is a chemical compound with the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. IUPAC name: tert-butyl N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-methylcarbamate. InChIKey: UZCLOPOHPILASZ-UHFFFAOYSA-N.
| Molecular formula | C9H19N3O3 |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | tert-butyl N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-methylcarbamate |
| InChIKey | UZCLOPOHPILASZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC/C(=N/O)/N |
Computed by PubChem (NCBI)