Products 1251422-95-3
CAS 1251422-95-3 is the registry number for tert-Butyl N-(1-(N'-hydroxycarbamimidoyl)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]carbamate (CAS 1251422-95-3) is a chemical compound with the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. IUPAC name: tert-butyl N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]carbamate. InChIKey: VBSXYTLJKCZCSW-UHFFFAOYSA-N.
| Molecular formula | C9H19N3O3 |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | tert-butyl N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]carbamate |
| InChIKey | VBSXYTLJKCZCSW-UHFFFAOYSA-N |
| SMILES | CC(C/C(=N/O)/N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)