Products 184002-61-7

CAS 184002-61-7 is the registry number for tert-Butyl N-(1-(hydrazinecarbonyl)-1-methylethyl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)carbamate (CAS 184002-61-7) is a chemical compound with the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. IUPAC name: tert-butyl N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)carbamate. InChIKey: WVUSJMQQIHKEMR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19N3O3
Molecular weight217.27 g/mol
IUPAC nametert-butyl N-(1-hydrazinyl-2-methyl-1-oxopropan-2-yl)carbamate
InChIKeyWVUSJMQQIHKEMR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(C)(C)C(=O)NN

Computed by PubChem (NCBI)