Products 860653-06-1

CAS 860653-06-1 is the registry number for tert-Butyl N-(3-(hydrazinecarbonyl)propyl)carbamate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-hydrazinyl-4-oxobutyl)carbamate (CAS 860653-06-1) is a chemical compound with the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. IUPAC name: tert-butyl N-(4-hydrazinyl-4-oxobutyl)carbamate. InChIKey: HHKLJPQIOGTFBN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19N3O3
Molecular weight217.27 g/mol
IUPAC nametert-butyl N-(4-hydrazinyl-4-oxobutyl)carbamate
InChIKeyHHKLJPQIOGTFBN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCC(=O)NN

Computed by PubChem (NCBI)