CAS 1251489-38-9 appears in our catalog under these names: tert-Butyl N-(2-(N'-hydroxycarbamimidoyl)-2-methylethyl)carbamate, 95%, tert-Butyl N-(2-(N'-hydroxycarbamimidoyl)-2-methylethyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]carbamate (CAS 1251489-38-9) is a chemical compound with the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. IUPAC name: tert-butyl N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]carbamate. InChIKey: NXWDWKLIOMWYEX-UHFFFAOYSA-N.
| Molecular formula | C9H19N3O3 |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | tert-butyl N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]carbamate |
| InChIKey | NXWDWKLIOMWYEX-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)OC(C)(C)C)/C(=N/O)/N |
Computed by PubChem (NCBI)