Products 1142922-55-1
CAS 1142922-55-1 appears in our catalog under these names: Comosone II, Comosone II, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg, 10mg, 20mg, 50mg.
(4aS,8aR)-4,7-dimethyl-1-propan-2-ylidene-4a,5,6,8a-tetrahydronaphthalen-2-one (CAS 1142922-55-1) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (4aS,8aR)-4,7-dimethyl-1-propan-2-ylidene-4a,5,6,8a-tetrahydronaphthalen-2-one. InChIKey: WFCQRHPAVQIDTH-CHWSQXEVSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (4aS,8aR)-4,7-dimethyl-1-propan-2-ylidene-4a,5,6,8a-tetrahydronaphthalen-2-one |
| InChIKey | WFCQRHPAVQIDTH-CHWSQXEVSA-N |
| SMILES | CC1=C[C@@H]2[C@H](CC1)C(=CC(=O)C2=C(C)C)C |
Computed by PubChem (NCBI)