CAS 1413723-36-0 is the registry number for 6-Oxo (S)-ar-Himachalene. Offered by: TRC. Available pack sizes: 50mg.
(9S)-3,5,5,9-tetramethyl-8,9-dihydro-7H-benzo[7]annulen-6-one (CAS 1413723-36-0) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (9S)-3,5,5,9-tetramethyl-8,9-dihydro-7H-benzo[7]annulen-6-one. InChIKey: GBMQNNWIDRLKML-NSHDSACASA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (9S)-3,5,5,9-tetramethyl-8,9-dihydro-7H-benzo[7]annulen-6-one |
| InChIKey | GBMQNNWIDRLKML-NSHDSACASA-N |
| SMILES | C[C@H]1CCC(=O)C(C2=C1C=CC(=C2)C)(C)C |
Computed by PubChem (NCBI)