CAS 114306-17-1 appears in our catalog under these names: 6-Bromo-1H-indol-3-yl acetate, 6-Bromo-1H-indol-3-yl acetate 98%, 6-Bromo-1H-indol-3-yl acetate, 98%, 98%, 6-Bromo-1H-indol-3-yl acetate, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 100mg.
(6-bromo-1H-indol-3-yl) acetate (CAS 114306-17-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: (6-bromo-1H-indol-3-yl) acetate. InChIKey: LNTDPDLGBFTITA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | (6-bromo-1H-indol-3-yl) acetate |
| InChIKey | LNTDPDLGBFTITA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CNC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)