CAS 1144-20-3 appears in our catalog under these names: 2-Phenylquinolin-4-ol, 95%, 4-Hydroxy-2-phenylquinoline, >95% (HPLC), 2-Phenylquinolin-4-ol 95+%, 2-Phenylquinolin-4-ol, 95%+, 95%+, 2-phenyl-1,4-dihydroquinolin-4-one, 95+%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 50mg.
2-phenyl-1H-quinolin-4-one (CAS 1144-20-3) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2-phenyl-1H-quinolin-4-one. InChIKey: JGABMVVOXLQCKZ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-phenyl-1H-quinolin-4-one |
| InChIKey | JGABMVVOXLQCKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)