Products 1947-47-3
CAS 1947-47-3 appears in our catalog under these names: 3-Amino-2-phenylindenone, 3-Amino-2-phenylindenone, 95%, 3-Amino-2-phenyl-1H-inden-1-one, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 25g, 100mg.
3-amino-2-phenylinden-1-one (CAS 1947-47-3) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 3-amino-2-phenylinden-1-one. InChIKey: HLEKBTIHDXNOQP-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 3-amino-2-phenylinden-1-one |
| InChIKey | HLEKBTIHDXNOQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C2=O)N |
Computed by PubChem (NCBI)