CAS 35776-95-5 is the registry number for 4-(4-Methylbenzoyl)benzonitrile, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-(4-methylbenzoyl)benzonitrile (CAS 35776-95-5) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 4-(4-methylbenzoyl)benzonitrile. InChIKey: TZLPNFGBHSHCDP-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(4-methylbenzoyl)benzonitrile |
| InChIKey | TZLPNFGBHSHCDP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)