CAS 34810-13-4 appears in our catalog under these names: 9-Anthraldehyde oxime, 95%, 9-Anthraldoxime, 9-Anthraldehyde oxime, predominantly syn, 9-anthraldehyde oxime, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 1g.
Anthracene-9-carboxamide (CAS 34810-13-4) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: anthracene-9-carboxamide. InChIKey: QHWJYCGQHFPQCA-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | anthracene-9-carboxamide |
| InChIKey | QHWJYCGQHFPQCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C(=O)N |
Computed by PubChem (NCBI)