CAS 838-41-5 appears in our catalog under these names: 2,4-Diphenyloxazole, 98%, 2,4-Diphenyloxazole, 99%, 2,4–Diphenyloxazole, 2,4-Diphenyloxazole, >99.0%(GC), 2,4-Diphenyloxazole, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 200mg.
2,4-diphenyl-1,3-oxazole (CAS 838-41-5) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2,4-diphenyl-1,3-oxazole. InChIKey: VUPXKQHLZATXTR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2,4-diphenyl-1,3-oxazole |
| InChIKey | VUPXKQHLZATXTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=COC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)