Products 114432-00-7
CAS 114432-00-7 appears in our catalog under these names: 8-Chloro-5,6,7,8-tetrahydroquinoline hydrochloride, 95%, 8-Chloro-5,6,7,8-tetrahydro-quinoline Hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
8-chloro-5,6,7,8-tetrahydroquinoline;hydrochloride (CAS 114432-00-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 8-chloro-5,6,7,8-tetrahydroquinoline;hydrochloride. InChIKey: CIIMLMHZIAAHJB-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 8-chloro-5,6,7,8-tetrahydroquinoline;hydrochloride |
| InChIKey | CIIMLMHZIAAHJB-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=N2)Cl.Cl |
Computed by PubChem (NCBI)