CAS 114567-34-9 appears in our catalog under these names: Boeravinone B, Boeravinone B, 6,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid, Boeravinone B (Standard), Boeravinone B, 97.59%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 50mg, 25mg, Get quote, 1 mg.
6,9,11-trihydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one (CAS 114567-34-9) is a chemical compound with the molecular formula C17H12O6 and a molecular weight of 312.27 g/mol. IUPAC name: 6,9,11-trihydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one. InChIKey: YVVDYYFGAWQOGB-UHFFFAOYSA-N.
| Molecular formula | C17H12O6 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | 6,9,11-trihydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one |
| InChIKey | YVVDYYFGAWQOGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1O)OC3=C(C2=O)C4=CC=CC=C4OC3O)O |
Computed by PubChem (NCBI)