CAS 75697-70-0 appears in our catalog under these names: Emodin Impurity 9, 3-(Acetyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate (CAS 75697-70-0) is a chemical compound with the molecular formula C17H12O6 and a molecular weight of 312.27 g/mol. IUPAC name: (4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate. InChIKey: REDOZVNQSRFUGL-UHFFFAOYSA-N.
| Molecular formula | C17H12O6 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | (4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) acetate |
| InChIKey | REDOZVNQSRFUGL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)OC(=O)C |
Computed by PubChem (NCBI)