CAS 2746-86-3 is the registry number for Acicerone. Offered by: Biosynth. Available pack sizes: 1mg.
3-(1,3-benzodioxol-5-yl)-6-hydroxy-7-methoxychromen-4-one (CAS 2746-86-3) is a chemical compound with the molecular formula C17H12O6 and a molecular weight of 312.27 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-6-hydroxy-7-methoxychromen-4-one. InChIKey: WKFSLLANSCHECV-UHFFFAOYSA-N.
| Molecular formula | C17H12O6 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-6-hydroxy-7-methoxychromen-4-one |
| InChIKey | WKFSLLANSCHECV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)OC=C(C2=O)C3=CC4=C(C=C3)OCO4)O |
Computed by PubChem (NCBI)