CAS 780821-74-1 is the registry number for 7,7'-Dihydroxy-4,4'-spirobi[chromene]-2,2'(3h,3'h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7,7'-dihydroxy-4,4'-spirobi[3H-chromene]-2,2'-dione (CAS 780821-74-1) is a chemical compound with the molecular formula C17H12O6 and a molecular weight of 312.27 g/mol. IUPAC name: 7,7'-dihydroxy-4,4'-spirobi[3H-chromene]-2,2'-dione. InChIKey: RMQHSNYXQLJJFO-UHFFFAOYSA-N.
| Molecular formula | C17H12O6 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | 7,7'-dihydroxy-4,4'-spirobi[3H-chromene]-2,2'-dione |
| InChIKey | RMQHSNYXQLJJFO-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC2=C(C13CC(=O)OC4=C3C=CC(=C4)O)C=CC(=C2)O |
Computed by PubChem (NCBI)