Products 52706-07-7
CAS 52706-07-7 is the registry number for Scillascillin. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
(3R)-5,7-dihydroxyspiro[2H-chromene-3,4'-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene]-4-one (CAS 52706-07-7) is a chemical compound with the molecular formula C17H12O6 and a molecular weight of 312.27 g/mol. IUPAC name: (3R)-5,7-dihydroxyspiro[2H-chromene-3,4'-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene]-4-one. InChIKey: SAXOGBBWXWKZKR-KRWDZBQOSA-N.
| Molecular formula | C17H12O6 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | (3R)-5,7-dihydroxyspiro[2H-chromene-3,4'-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,6-triene]-4-one |
| InChIKey | SAXOGBBWXWKZKR-KRWDZBQOSA-N |
| SMILES | C1C2=CC3=C(C=C2[C@@]14COC5=CC(=CC(=C5C4=O)O)O)OCO3 |
Computed by PubChem (NCBI)
Synonyms:
Scillascillin, orb1681736